Compound Information | SONAR Target prediction | Name: | FRIEDELIN | Unique Identifier: | SPE00100551 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 1.503 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1C(=O)CCC2C1(C)CCC1C2(C)CCC2(C)C3CC(C)(C)CCC3(C)CCC12C | Class: | triterpene | Source: | Ceratopetalum apetalum D. Don, Cunoniaceae | Reference: | J Chem Soc 1954: 473 | Generic_name: | 5ALPHA-ANDROSTAN-3,17-DIONE | Chemical_iupac_name: | 5ALPHA-ANDROSTAN-3,17-DIONE | Drug_type: | Experimental | Drugbank_id: | EXPT00262 | Drug_category: | Estradiol 17 Beta-Dehydrogenase 1 inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
VPS1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5586±0.000636396 |
Normalized OD Score: sc h |
0.8764±0.0072344 |
Z-Score: |
-4.8922±0.127697 |
p-Value: |
0.00000109956 |
Z-Factor: |
-7.12208 |
Fitness Defect: |
13.7206 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 2|C5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.20 Celcius | Date: | 2007-10-03 YYYY-MM-DD | Plate CH Control (+): | 0.0403±0.00310 | Plate DMSO Control (-): | 0.635675±0.11574 | Plate Z-Factor: | 0.3704 |
| png ps pdf |
157139 |
(1S,5R)-6,6-dimethylnorpinan-2-one |
157582 |
7,7-dimethylnorpinan-6-one |
159055 |
(1R,4R)-1,7,7-trimethylnorbornan-2-one |
161676 |
n/a |
161875 |
2-dodecylcyclobutan-1-one |
162267 |
2-methyldodecanal |
internal high similarity DBLink | Rows returned: 17 | 1 2 3 Next >> |
active | Cluster 183 | Additional Members: 2 | Rows returned: 0 | |
|