| 
 | Compound Information | SONAR Target prediction |  | Name: | FRIEDELIN |  | Unique Identifier: | SPE00100551 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 376.32 g/mol |  | X log p: | 1.503  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 1 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | CC1C(=O)CCC2C1(C)CCC1C2(C)CCC2(C)C3CC(C)(C)CCC3(C)CCC12C |  | Class: | triterpene |  | Source: | Ceratopetalum apetalum D. Don, Cunoniaceae |  | Reference: | J Chem Soc 1954: 473 |  | Generic_name: | 5ALPHA-ANDROSTAN-3,17-DIONE |  | Chemical_iupac_name: | 5ALPHA-ANDROSTAN-3,17-DIONE |  | Drug_type: | Experimental |  | Drugbank_id: | EXPT00262 |  | Drug_category: | Estradiol 17 Beta-Dehydrogenase 1 inhibitor |  | Organisms_affected: | -1 | 
 
 
	
		| Species: | 4932 |  
		| Condition: | ARF1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6029±0.00304056 |  
		| Normalized OD Score: sc h | 0.9015±0.00255381 |  
		| Z-Score: | -4.7724±0.108005 |  
		| p-Value: | 0.00000194751 |  
		| Z-Factor: | -7.83808 |  
		| Fitness Defect: | 13.149 |  
		| Bioactivity Statement: | Active |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 2|C5 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.80 Celcius |  | Date: | 2007-10-02 YYYY-MM-DD |  | Plate CH Control (+): | 0.04085±0.00056 |  | Plate DMSO Control (-): | 0.6660999999999999±0.11265 |  | Plate Z-Factor: | 0.4349 | 
 |  png ps
 pdf
 | 
 
 
	
		| 6914115 | 2,2,4,4,16,16-hexadeuterio-10,13-dimethyl-1,5,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,1 7-dione
 |  
		| 6915922 | (2R)-2-methylundecanal |  
		| 6934721 | n/a |  
		| 6955093 | (5S,8S,9S,10R,13S,14S)-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthr ene-3,17-dione
 |  
		| 6973627 | (5S,8R,9S,10R,13R,14R)-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthr ene-3,17-dione
 |  
		| 6976372 | n/a |  
 | internal high similarity DBLink  | Rows returned: 17 | 1 2 3 Next >> | 
 
 | active | Cluster 183 | Additional Members: 2 | Rows returned: 0 |  | 
 
 |