Compound Information | SONAR Target prediction | Name: | FRIEDELIN | Unique Identifier: | SPE00100551 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 1.503 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1C(=O)CCC2C1(C)CCC1C2(C)CCC2(C)C3CC(C)(C)CCC3(C)CCC12C | Class: | triterpene | Source: | Ceratopetalum apetalum D. Don, Cunoniaceae | Reference: | J Chem Soc 1954: 473 | Generic_name: | 5ALPHA-ANDROSTAN-3,17-DIONE | Chemical_iupac_name: | 5ALPHA-ANDROSTAN-3,17-DIONE | Drug_type: | Experimental | Drugbank_id: | EXPT00262 | Drug_category: | Estradiol 17 Beta-Dehydrogenase 1 inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
POP2 |
Replicates: |
2 |
Raw OD Value: r im |
0.5506±0.00410122 |
Normalized OD Score: sc h |
0.8509±0.000646126 |
Z-Score: |
-6.9919±0.60079 |
p-Value: |
0.0000000000257152 |
Z-Factor: |
-2.29204 |
Fitness Defect: |
24.3839 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 2|C5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.30 Celcius | Date: | 2007-10-24 YYYY-MM-DD | Plate CH Control (+): | 0.041225±0.00114 | Plate DMSO Control (-): | 0.6479999999999999±0.09167 | Plate Z-Factor: | 0.5233 |
| png ps pdf |
6559195 |
n/a |
6559465 |
(5S,8R,9R,10S,13R,14S)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenan thren-17-one |
6560191 |
(1S,4S)-1,3,3-trimethylnorbornan-2-one |
6566099 |
1-[(5S,8R,9S,10R,13S,14R,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclope nta[a]phenanthren-17-yl]ethanone |
6567187 |
(5R,8S,9S,10R,13S,14R)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenan thren-17-one |
6569133 |
n/a |
internal high similarity DBLink | Rows returned: 17 | 1 2 3 Next >> |
active | Cluster 183 | Additional Members: 2 | Rows returned: 0 | |
|