Compound Information | SONAR Target prediction | Name: | FRIEDELIN | Unique Identifier: | SPE00100551 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 1.503 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1C(=O)CCC2C1(C)CCC1C2(C)CCC2(C)C3CC(C)(C)CCC3(C)CCC12C | Class: | triterpene | Source: | Ceratopetalum apetalum D. Don, Cunoniaceae | Reference: | J Chem Soc 1954: 473 | Generic_name: | 5ALPHA-ANDROSTAN-3,17-DIONE | Chemical_iupac_name: | 5ALPHA-ANDROSTAN-3,17-DIONE | Drug_type: | Experimental | Drugbank_id: | EXPT00262 | Drug_category: | Estradiol 17 Beta-Dehydrogenase 1 inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
FUR4 |
Replicates: |
2 |
Raw OD Value: r im |
0.3126±0.0227688 |
Normalized OD Score: sc h |
0.7126±0.0317196 |
Z-Score: |
-7.5312±0.518778 |
p-Value: |
0.000000000000392168 |
Z-Factor: |
0.382484 |
Fitness Defect: |
28.5671 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 2|C5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.80 Celcius | Date: | 2006-03-22 YYYY-MM-DD | Plate CH Control (+): | 0.039599999999999996±0.00158 | Plate DMSO Control (-): | 0.44085±0.01258 | Plate Z-Factor: | 0.9060 |
| png ps pdf |
3388264 |
hexatetracontane-19,28-dione |
3404028 |
2,2-dimethylundecan-3-one |
3460636 |
11-methyldodecane-3,8-dione |
3467034 |
10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,16,17-tetradecahydrocyclopenta[a]phenanthren-15-one |
3480770 |
2,8-dimethylnonan-3-one |
3505784 |
henicosan-10-one |
internal high similarity DBLink | Rows returned: 17 | 1 2 3 Next >> |
active | Cluster 183 | Additional Members: 2 | Rows returned: 0 | |
|