Compound Information | SONAR Target prediction | Name: | FRIEDELIN | Unique Identifier: | SPE00100551 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 1.503 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1C(=O)CCC2C1(C)CCC1C2(C)CCC2(C)C3CC(C)(C)CCC3(C)CCC12C | Class: | triterpene | Source: | Ceratopetalum apetalum D. Don, Cunoniaceae | Reference: | J Chem Soc 1954: 473 | Generic_name: | 5ALPHA-ANDROSTAN-3,17-DIONE | Chemical_iupac_name: | 5ALPHA-ANDROSTAN-3,17-DIONE | Drug_type: | Experimental | Drugbank_id: | EXPT00262 | Drug_category: | Estradiol 17 Beta-Dehydrogenase 1 inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
ARF1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6029±0.00304056 |
Normalized OD Score: sc h |
0.9015±0.00255381 |
Z-Score: |
-4.7724±0.108005 |
p-Value: |
0.00000194751 |
Z-Factor: |
-7.83808 |
Fitness Defect: |
13.149 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 2|C5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.80 Celcius | Date: | 2007-10-02 YYYY-MM-DD | Plate CH Control (+): | 0.04085±0.00056 | Plate DMSO Control (-): | 0.6660999999999999±0.11265 | Plate Z-Factor: | 0.4349 |
| png ps pdf |
609522 |
n/a |
609723 |
4,4,10,13,14-pentamethyl-17-(6-methylheptan-2-yl)-1,2,3,5,6,7,8,9,12,15,16,17-dodecahydrocyclopenta[a]ph enanthren-11-one |
609798 |
n/a |
610000 |
4,4,10,13,14-pentamethyl-17-(6-methylheptan-2-yl)-1,2,3,5,6,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]p henanthren-7-one |
612154 |
10,13-dimethyl-1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-2-one |
612291 |
10,13,17-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-16-one |
active | Cluster 183 | Additional Members: 2 | Rows returned: 0 | |
|