| 
 | Compound Information | SONAR Target prediction |  | Name: | FRIEDELIN |  | Unique Identifier: | SPE00100551 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 376.32 g/mol |  | X log p: | 1.503  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 1 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | CC1C(=O)CCC2C1(C)CCC1C2(C)CCC2(C)C3CC(C)(C)CCC3(C)CCC12C |  | Class: | triterpene |  | Source: | Ceratopetalum apetalum D. Don, Cunoniaceae |  | Reference: | J Chem Soc 1954: 473 |  | Generic_name: | 5ALPHA-ANDROSTAN-3,17-DIONE |  | Chemical_iupac_name: | 5ALPHA-ANDROSTAN-3,17-DIONE |  | Drug_type: | Experimental |  | Drugbank_id: | EXPT00262 |  | Drug_category: | Estradiol 17 Beta-Dehydrogenase 1 inhibitor |  | Organisms_affected: | -1 | 
 
 
	
		| Species: | 4932 |  
		| Condition: | VPS1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.5586±0.000636396 |  
		| Normalized OD Score: sc h | 0.8764±0.0072344 |  
		| Z-Score: | -4.8922±0.127697 |  
		| p-Value: | 0.00000109956 |  
		| Z-Factor: | -7.12208 |  
		| Fitness Defect: | 13.7206 |  
		| Bioactivity Statement: | Active |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 2|C5 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.20 Celcius |  | Date: | 2007-10-03 YYYY-MM-DD |  | Plate CH Control (+): | 0.0403±0.00310 |  | Plate DMSO Control (-): | 0.635675±0.11574 |  | Plate Z-Factor: | 0.3704 | 
 |  png ps
 pdf
 | 
 
 
	
		| 579648 | n/a |  
		| 579683 | 1-norcaran-7-ylpentan-1-one |  
		| 579761 | 1-norcaran-7-ylbutan-1-one |  
		| 579869 | 4,4a,6a,6b,8a,11,12,14a-octamethyl-1,2,4,5,6,6a,7,8,9,10,11,12,12a,13,14,14b-hexadecahydropicen-3-one |  
		| 579990 | cobalt; cyclooctane; cyclopentanecarbaldehyde |  
		| 580287 | cobalt; cyclooctane; 1-cyclopentylpropan-1-one |  
 | internal high similarity DBLink  | Rows returned: 17 | 1 2 3 Next >> | 
 
 | active | Cluster 183 | Additional Members: 2 | Rows returned: 0 |  | 
 
 |