Compound Information | SONAR Target prediction | Name: | OLEANOIC ACID | Unique Identifier: | SPE00100550 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 408.319 g/mol | X log p: | 1.05 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC1(C)CCC2(CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1)C(O)=O | Class: | triterpene | Source: | leaves of Olea europea and Viscum album L. | Reference: | J Chem Soc (C) 1939: 1047 |
Species: |
4932 |
Condition: |
MRT4 |
Replicates: |
2 |
Raw OD Value: r im |
0.7079±0.0292742 |
Normalized OD Score: sc h |
1.4544±0.0641849 |
Z-Score: |
15.2491±4.32858 |
p-Value: |
1.7926e-34 |
Z-Factor: |
-0.201237 |
Fitness Defect: |
77.7042 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 2|C6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.80 Celcius | Date: | 2007-08-30 YYYY-MM-DD | Plate CH Control (+): | 0.03949999999999999±0.00059 | Plate DMSO Control (-): | 0.46475±0.05332 | Plate Z-Factor: | 0.4602 |
| png ps pdf |
6454401 |
(1S,2R,4aS,6aS,6aS,6bR,12aS,14bS)-1,2,6a,6b,9,9,12a-heptamethyl-10-oxo-1,2,3,4,5,6,6a,7,8,8a,11,12,13,14 b-tetradecahydropicene-4a-carboxylic acid |
6476239 |
(E,8S)-2-butyl-10-hydroxy-4,8-dimethyl-dec-4-enoic acid |
6476240 |
(E,8S)-10-hydroxy-4,8-dimethyl-2-pentan-2-yl-dec-4-enoic acid |
6476241 |
(E,8S)-2-hexyl-10-hydroxy-4,8-dimethyl-dec-4-enoic acid |
6563072 |
(4aR,6aR,6aS,6bR,8aR,10S,12aR,14bR)-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,1 2,13,14b-tetradecahydropicene-4a-carboxylate |
6563073 |
(4aR,6aR,6aS,6bR,8aR,10S,12aR,14bR)-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,1 2,13,14b-tetradecahydropicene-4a-carboxylic acid |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
nonactive | Cluster 1623 | Additional Members: 8 | Rows returned: 6 | |
|