| Compound Information | SONAR Target prediction | | Name: | OLEANOIC ACID | | Unique Identifier: | SPE00100550 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 408.319 g/mol | | X log p: | 1.05 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | CC1(C)CCC2(CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1)C(O)=O | | Class: | triterpene | | Source: | leaves of Olea europea and Viscum album L. | | Reference: | J Chem Soc (C) 1939: 1047 |
| Species: |
4932 |
| Condition: |
NUP100 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.9164±0.13435 |
| Normalized OD Score: sc h |
1.2135±0.19413 |
| Z-Score: |
14.5281±13.1457 |
| p-Value: |
0.0000000835682 |
| Z-Factor: |
-2.54358 |
| Fitness Defect: |
16.2976 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 2|C6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 28.60 Celcius | | Date: | 2007-08-28 YYYY-MM-DD | | Plate CH Control (+): | 0.0404±0.00056 | | Plate DMSO Control (-): | 0.7372750000000001±0.03571 | | Plate Z-Factor: | 0.8165 |
| png ps pdf |
| 510096 |
(4aR,6bR,10R,12aS)-10-hydroxy-2,2,6b,9,9,12a-hexamethyl-3,4,5,6,6a,6a,7,8,8a,10,11,12,13,14b-tetradecahy dro-1H-picene-4a-carboxylic acid |
| 533675 |
n/a |
| 584300 |
2-(3,4,5,6,7,8-hexahydro-2H-naphthalen-4a-yl)acetic acid |
| 602302 |
3-(2,6,6-trimethyl-1-cyclohexenyl)propanoic acid |
| 619166 |
10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-car boxylic acid |
| 619168 |
2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
| active | Cluster 1623 | Additional Members: 8 | Rows returned: 4 | |
|