| Compound Information | SONAR Target prediction | | Name: | OLEANOIC ACID | | Unique Identifier: | SPE00100550 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 408.319 g/mol | | X log p: | 1.05 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | CC1(C)CCC2(CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1)C(O)=O | | Class: | triterpene | | Source: | leaves of Olea europea and Viscum album L. | | Reference: | J Chem Soc (C) 1939: 1047 |
| Species: |
4932 |
| Condition: |
MRT4 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7079±0.0292742 |
| Normalized OD Score: sc h |
1.4544±0.0641849 |
| Z-Score: |
15.2491±4.32858 |
| p-Value: |
1.7926e-34 |
| Z-Factor: |
-0.201237 |
| Fitness Defect: |
77.7042 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 2|C6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.80 Celcius | | Date: | 2007-08-30 YYYY-MM-DD | | Plate CH Control (+): | 0.03949999999999999±0.00059 | | Plate DMSO Control (-): | 0.46475±0.05332 | | Plate Z-Factor: | 0.4602 |
|  png
ps
pdf |
| 290078 |
cyclohept-3-ene-1-carboxylic acid |
| 292830 |
2-(1-cyclopent-2-enyl)tetradecanoic acid |
| 317027 |
13-methyl-17-(6-methylheptan-2-yl)-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenant
hrene-3-carboxylic acid |
| 338181 |
(1S,2R,4aR,6aS,6aS,6bR,8aS,10S,12aS,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,
10,11,12,13,14b-tetradecahydro-1H-picene-1-carboxylic acid |
| 441936 |
n/a |
| 458100 |
10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenan
threne-3-carboxylic acid |
| internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
| active | Cluster 1623 | Additional Members: 8 | Rows returned: 4 | |
|
