| Compound Information | SONAR Target prediction |
| Name: | DIHYDROSPATHELIACHROMENE |
| Unique Identifier: | SPE00100531 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C15H16O4 |
| Molecular Weight: | 244.158 g/mol |
| X log p: | 4.348 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 35.53 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 4 |
| Rotatable Bond Count: | 0 |
| Canonical Smiles: | CC1Oc2cc3OC(C)(C)CCc3c(O)c2C(=O)C=1 |
| Source: | ex Spathelia sorbifolia |
| Reference: | Indian J Chem 8: 480 (1970) |
| Found: 101 nonactive as graph: single | with analogs | [1] << Back 91 92 93 94 95 96 97 98 99 100 Next >> [101] |
| Species: | 4932 |
| Condition: | TOP1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6341±0.00353553 |
| Normalized OD Score: sc h | 0.9956±0.00247865 |
| Z-Score: | -0.0696±0.0365056 |
| p-Value: | 0.944496 |
| Z-Factor: | -40.0341 |
| Fitness Defect: | 0.0571 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 1 |
| 609688 |
| internal high similarity DBLink | Rows returned: 0 |
| nonactive | Cluster 4376 | Additional Members: 4 | Rows returned: 3 |
| SPE00200447 | 0.542372881355932 |
| SPE00100513 | 0.419354838709677 |
| SPE00100719 | 0 |
Service provided by the
Mike Tyers Laboratory