| Compound Information | SONAR Target prediction |
| Name: | PEUCENIN |
| Unique Identifier: | SPE00100528 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 244.158 g/mol |
| X log p: | 6.645 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 26.3 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 4 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | CC(C)=CCc1c(O)cc2OC(C)=CC(=O)c2c1O |
| Class: | chromone |
| Source: | Peucedanum ostruthium, Ptaeroxylon obliquum |
| Reference: | Ber 74:1851 (1941); J Chem Soc (C) 1967:145 |
| Found: 37 active | as graph: single | with analogs | [1] << Back 31 32 33 34 35 36 37 Next >> [37] |
| Species: | 4932 |
| Condition: | BY4741-3rd |
| Replicates: | 2 |
| Raw OD Value: r im | 0.8900±0.00650538 |
| Normalized OD Score: sc h | 0.8912±0.00138653 |
| Z-Score: | -4.3739±0.170345 |
| p-Value: | 0.0000140124 |
| Z-Factor: | -7.19578 |
| Fitness Defect: | 11.1756 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 1 |
| 68477 | 5,7-dihydroxy-2-methyl-6-(3-methylbut-2-enyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 3 |
| SPE00100529 | 0.9417 |
| SPE00200449 | 0.9478 |
| SPE00200447 | 0.9823 |
| active | Cluster 18131 | Additional Members: 2 | Rows returned: 1 |
| SPE01504015 | 0 |
Service provided by the
Mike Tyers Laboratory