Compound Information | SONAR Target prediction | Name: | beta-AMYRIN | Unique Identifier: | SPE00100360 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.864 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 | Class: | triterpene | Source: | widespread in plants | Reference: | Phytochemistry 9: 1669 (1970) | Generic_name: | 16,17-ANDROSTENE-3-OL | Chemical_iupac_name: | 16,17-ANDROSTENE-3-OL | Drug_type: | Experimental | Drugbank_id: | EXPT00580 | Logp: | 4.38 | Drug_category: | Constitutive Androstane Receptor inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
TRK1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5152±0.00247487 |
Normalized OD Score: sc h |
1.0212±0.00774822 |
Z-Score: |
0.6480±0.245903 |
p-Value: |
0.523248 |
Z-Factor: |
-4.61909 |
Fitness Defect: |
0.6477 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 10|F3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.50 Celcius | Date: | 2008-03-14 YYYY-MM-DD | Plate CH Control (+): | 0.0403±0.00050 | Plate DMSO Control (-): | 0.47702500000000003±0.02062 | Plate Z-Factor: | 0.8504 |
| png ps pdf |
276594 |
3,5,10,13-tetramethyl-1,4,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-ol |
281317 |
3-(6-bicyclo[2.2.1]hept-2-enyl)propan-1-ol |
293011 |
tetracos-15-en-1-ol |
312796 |
17-(5,6-dimethylheptan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phe nanthren-3-ol |
314393 |
17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclo penta[a]phenanthren-3-ol |
319259 |
17-ethyl-13-methyl-2,3,4,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|