Compound Information | SONAR Target prediction | Name: | beta-AMYRIN | Unique Identifier: | SPE00100360 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.864 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 | Class: | triterpene | Source: | widespread in plants | Reference: | Phytochemistry 9: 1669 (1970) | Generic_name: | 16,17-ANDROSTENE-3-OL | Chemical_iupac_name: | 16,17-ANDROSTENE-3-OL | Drug_type: | Experimental | Drugbank_id: | EXPT00580 | Logp: | 4.38 | Drug_category: | Constitutive Androstane Receptor inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
REF2 |
Replicates: |
2 |
Raw OD Value: r im |
0.3572±0.0205061 |
Normalized OD Score: sc h |
0.9651±0.0142056 |
Z-Score: |
-1.0175±0.416374 |
p-Value: |
0.329606 |
Z-Factor: |
-1.97362 |
Fitness Defect: |
1.1099 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 10|F3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.50 Celcius | Date: | 2008-08-27 YYYY-MM-DD | Plate CH Control (+): | 0.041800000000000004±0.00098 | Plate DMSO Control (-): | 0.343075±0.01020 | Plate Z-Factor: | 0.9498 |
| png ps pdf |
246877 |
17-ethyl-10,13-dimethyl-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol |
246879 |
(5S,8S,9S,10S,13S,14S,17R)-10,13-dimethyl-17-propan-2-yl-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclope nta[a]phenanthren-17-ol |
247013 |
(5S,8S,9S,10S,13S,14S,17S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phen anthren-17-ol |
247835 |
(5S,8S,9S,10S,13S,14S,17S)-10,13-dimethyl-17-propyl-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a ]phenanthren-17-ol |
252818 |
(8R,9R,10R,13S,14S,17S)-13-methyl-1,2,3,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanth ren-17-ol |
268019 |
dec-7-en-1-ol |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|