Compound Information | SONAR Target prediction | Name: | beta-AMYRIN | Unique Identifier: | SPE00100360 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.864 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 | Class: | triterpene | Source: | widespread in plants | Reference: | Phytochemistry 9: 1669 (1970) | Generic_name: | 16,17-ANDROSTENE-3-OL | Chemical_iupac_name: | 16,17-ANDROSTENE-3-OL | Drug_type: | Experimental | Drugbank_id: | EXPT00580 | Logp: | 4.38 | Drug_category: | Constitutive Androstane Receptor inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
DUN1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6903±0.0137886 |
Normalized OD Score: sc h |
0.9975±0.00713522 |
Z-Score: |
-0.1001±0.272163 |
p-Value: |
0.848144 |
Z-Factor: |
-14.221 |
Fitness Defect: |
0.1647 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 1|H10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.10 Celcius | Date: | 2006-04-20 YYYY-MM-DD | Plate CH Control (+): | 0.0379±0.00239 | Plate DMSO Control (-): | 0.690925±0.01134 | Plate Z-Factor: | 0.9317 |
| png ps pdf |
9442548 |
n/a |
9442549 |
n/a |
9442550 |
n/a |
11001144 |
(2S,4aS,4bS,6aR,10aS,10bR,12aS)-4a,6a,8-trimethyl-1,2,3,4,4b,5,6,7,10,10a,10b,11,12,12a-tetradecahydroch rysen-2-ol |
11944014 |
n/a |
11944015 |
n/a |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|