Compound Information | SONAR Target prediction | Name: | beta-AMYRIN | Unique Identifier: | SPE00100360 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.864 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 | Class: | triterpene | Source: | widespread in plants | Reference: | Phytochemistry 9: 1669 (1970) | Generic_name: | 16,17-ANDROSTENE-3-OL | Chemical_iupac_name: | 16,17-ANDROSTENE-3-OL | Drug_type: | Experimental | Drugbank_id: | EXPT00580 | Logp: | 4.38 | Drug_category: | Constitutive Androstane Receptor inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
CLN2 |
Replicates: |
2 |
Raw OD Value: r im |
0.7195±0.0115966 |
Normalized OD Score: sc h |
1.0023±0.0151401 |
Z-Score: |
-1.3263±0.745339 |
p-Value: |
0.24397 |
Z-Factor: |
-4.38211 |
Fitness Defect: |
1.4107 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 14|F6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2010-08-10 YYYY-MM-DD | Plate CH Control (+): | 0.08375±0.01283 | Plate DMSO Control (-): | 0.8485±0.04289 | Plate Z-Factor: | 0.7943 |
| png ps pdf |
9442548 |
n/a |
9442549 |
n/a |
9442550 |
n/a |
11001144 |
(2S,4aS,4bS,6aR,10aS,10bR,12aS)-4a,6a,8-trimethyl-1,2,3,4,4b,5,6,7,10,10a,10b,11,12,12a-tetradecahydroch rysen-2-ol |
11944014 |
n/a |
11944015 |
n/a |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|