| Compound Information | SONAR Target prediction | | Name: | beta-AMYRIN | | Unique Identifier: | SPE00100360 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 376.32 g/mol | | X log p: | 2.864 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 | | Class: | triterpene | | Source: | widespread in plants | | Reference: | Phytochemistry 9: 1669 (1970) | | Generic_name: | 16,17-ANDROSTENE-3-OL | | Chemical_iupac_name: | 16,17-ANDROSTENE-3-OL | | Drug_type: | Experimental | | Drugbank_id: | EXPT00580 | | Logp: | 4.38 | | Drug_category: | Constitutive Androstane Receptor inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
SRL3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6963±0.0013435 |
| Normalized OD Score: sc h |
0.9925±0.00788987 |
| Z-Score: |
-0.4220±0.457811 |
| p-Value: |
0.6888 |
| Z-Factor: |
-21.3939 |
| Fitness Defect: |
0.3728 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 10|F3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.10 Celcius | | Date: | 2008-09-17 YYYY-MM-DD | | Plate CH Control (+): | 0.041525000000000006±0.00046 | | Plate DMSO Control (-): | 0.6934750000000001±0.01627 | | Plate Z-Factor: | 0.9271 |
| png ps pdf |
| 9442548 |
n/a |
| 9442549 |
n/a |
| 9442550 |
n/a |
| 11001144 |
(2S,4aS,4bS,6aR,10aS,10bR,12aS)-4a,6a,8-trimethyl-1,2,3,4,4b,5,6,7,10,10a,10b,11,12,12a-tetradecahydroch rysen-2-ol |
| 11944014 |
n/a |
| 11944015 |
n/a |
| internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
| active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|