Compound Information | SONAR Target prediction | Name: | beta-AMYRIN | Unique Identifier: | SPE00100360 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.864 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 | Class: | triterpene | Source: | widespread in plants | Reference: | Phytochemistry 9: 1669 (1970) | Generic_name: | 16,17-ANDROSTENE-3-OL | Chemical_iupac_name: | 16,17-ANDROSTENE-3-OL | Drug_type: | Experimental | Drugbank_id: | EXPT00580 | Logp: | 4.38 | Drug_category: | Constitutive Androstane Receptor inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
APC9 |
Replicates: |
2 |
Raw OD Value: r im |
0.7281±0.00565685 |
Normalized OD Score: sc h |
1.0056±0.0214364 |
Z-Score: |
0.3142±1.1693 |
p-Value: |
0.43104 |
Z-Factor: |
-13.9411 |
Fitness Defect: |
0.8416 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 1|H10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 21.20 Celcius | Date: | 2007-11-22 YYYY-MM-DD | Plate CH Control (+): | 0.041575±0.00499 | Plate DMSO Control (-): | 0.7029000000000001±0.07674 | Plate Z-Factor: | 0.6152 |
| png ps pdf |
7077183 |
(2S)-4-[(1S,2R)-1,2,4-trimethyl-1-cyclohex-3-enyl]butan-2-ol |
7077184 |
(2S)-4-[(1S,2S)-1,2,4-trimethyl-1-cyclohex-3-enyl]butan-2-ol |
7077198 |
(3S)-1-[(1S,2S)-1,2,4-trimethyl-1-cyclohex-3-enyl]pentan-3-ol |
7077199 |
(3R)-1-[(1S,2S)-1,2,4-trimethyl-1-cyclohex-3-enyl]pentan-3-ol |
7093193 |
(3S,4aR,6aS,6aR,8aR,12aR,14aS,14bS)-4,4,6a,6a,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,8,9,10,12,12a,13,14,1 4a-tetradecahydropicen-3-ol |
7093194 |
(3S,4aS,6aS,6aR,8aR,12aR,14aS,14bS)-4,4,6a,6a,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,8,9,10,12,12a,13,14,1 4a-tetradecahydropicen-3-ol |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|