Compound Information | SONAR Target prediction | Name: | beta-AMYRIN | Unique Identifier: | SPE00100360 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.864 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 | Class: | triterpene | Source: | widespread in plants | Reference: | Phytochemistry 9: 1669 (1970) | Generic_name: | 16,17-ANDROSTENE-3-OL | Chemical_iupac_name: | 16,17-ANDROSTENE-3-OL | Drug_type: | Experimental | Drugbank_id: | EXPT00580 | Logp: | 4.38 | Drug_category: | Constitutive Androstane Receptor inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
ATP4 |
Replicates: |
2 |
Raw OD Value: r im |
0.6641±0.00219203 |
Normalized OD Score: sc h |
1.0107±0.00426336 |
Z-Score: |
0.3918±0.136384 |
p-Value: |
0.696576 |
Z-Factor: |
-19.1311 |
Fitness Defect: |
0.3616 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 10|F3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.00 Celcius | Date: | 2008-03-06 YYYY-MM-DD | Plate CH Control (+): | 0.03985±0.00055 | Plate DMSO Control (-): | 0.6351±0.01392 | Plate Z-Factor: | 0.9359 |
| png ps pdf |
103212 |
3-methyl-5-(2,2,3-trimethyl-1-cyclopent-3-enyl)pentan-2-ol |
106776 |
2-[2-(2,2,3-trimethyl-1-cyclopent-3-enyl)ethyl]cyclopentan-1-ol |
122857 |
(3S,4aS,6aR,6aS,6bR,8aR,14aS,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,6a,7,8,9,10,13,14,14a- tetradecahydropicen-3-ol |
151449 |
(3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenant hren-3-ol |
156497 |
n/a |
165590 |
n/a |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|