| 
 | Compound Information | SONAR Target prediction |  | Name: | beta-AMYRIN |  | Unique Identifier: | SPE00100360 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 376.32 g/mol |  | X log p: | 2.864  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 0 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 1 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 |  | Class: | triterpene |  | Source: | widespread in plants |  | Reference: | Phytochemistry 9: 1669 (1970) |  | Generic_name: | 16,17-ANDROSTENE-3-OL |  | Chemical_iupac_name: | 16,17-ANDROSTENE-3-OL |  | Drug_type: | Experimental |  | Drugbank_id: | EXPT00580 |  | Logp: | 4.38 |  | Drug_category: | Constitutive Androstane Receptor inhibitor |  | Organisms_affected: | -1 | 
 
 
	
		| Species: | 4932 |  
		| Condition: | MT2481-pdr1pdr3-2nd |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.5884±0.00565685 |  
		| Normalized OD Score: sc h | 0.9923±0.00546401 |  
		| Z-Score: | -0.8548±0.197983 |  
		| p-Value: | 0.39726 |  
		| Z-Factor: | -17.7965 |  
		| Fitness Defect: | 0.9232 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 10|F3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.80 Celcius |  | Date: | 2008-08-22 YYYY-MM-DD |  | Plate CH Control (+): | 0.040225±0.00066 |  | Plate DMSO Control (-): | 0.57525±0.01048 |  | Plate Z-Factor: | 0.9366 | 
 |  png ps
 pdf
 | 
 
 
	
		| 6575427 | (3S)-1-[(1R,2S)-1,2,4-trimethyl-1-cyclohex-3-enyl]pentan-3-ol |  
		| 6708529 | (3S,6aR,6bS,8aR,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahyd ropicen-3-ol
 |  
		| 6976791 | (8S,9R,10S,13R,14R,17R)-13-methyl-1,2,3,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanth ren-17-ol
 |  
		| 6979153 | n/a |  
		| 7002961 | (3R,4aS,6aR,6aS,8aS,12aS,14aR,14bR)-4,4,6a,6a,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,8,9,10,12,12a,13,14,1 4a-tetradecahydropicen-3-ol
 |  
		| 7052786 | (3R,5R,8R,9S,10S,13R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren -3-ol
 |  
 | internal high similarity DBLink  | Rows returned: 8 | 1 2 Next >> | 
 
 | active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 |  | 
 
 |