Compound Information | SONAR Target prediction | Name: | beta-AMYRIN | Unique Identifier: | SPE00100360 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.864 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 | Class: | triterpene | Source: | widespread in plants | Reference: | Phytochemistry 9: 1669 (1970) | Generic_name: | 16,17-ANDROSTENE-3-OL | Chemical_iupac_name: | 16,17-ANDROSTENE-3-OL | Drug_type: | Experimental | Drugbank_id: | EXPT00580 | Logp: | 4.38 | Drug_category: | Constitutive Androstane Receptor inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
ATP4 |
Replicates: |
2 |
Raw OD Value: r im |
0.6641±0.00219203 |
Normalized OD Score: sc h |
1.0107±0.00426336 |
Z-Score: |
0.3918±0.136384 |
p-Value: |
0.696576 |
Z-Factor: |
-19.1311 |
Fitness Defect: |
0.3616 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 10|F3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.00 Celcius | Date: | 2008-03-06 YYYY-MM-DD | Plate CH Control (+): | 0.03985±0.00055 | Plate DMSO Control (-): | 0.6351±0.01392 | Plate Z-Factor: | 0.9359 |
| png ps pdf |
6437607 |
(E)-octadec-9-en-1-olate; titanium(+4) cation |
6437789 |
(E)-2-[(E)-hexadec-7-enyl]icos-11-en-1-ol |
6440428 |
(E)-octadec-13-en-1-ol |
6441076 |
(3S,4S,5S,8S,9S,10S,13R,14S,17R)-4,10,13-trimethyl-17-[(E,2S,5R)-4,5,6-trimethylhept-3-en-2-yl]-2,3,4,5, 6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
6453642 |
(3S,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(E,2S,5S)-5-methylhept-3-en-2-yl]-2,3,4,5,6,7,8,9,11,12 ,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
6455741 |
(3R,6aR,6bS,8aR,12aS,14aS,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-te tradecahydropicen-3-ol |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|