Compound Information | SONAR Target prediction | Name: | beta-AMYRIN | Unique Identifier: | SPE00100360 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.864 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 | Class: | triterpene | Source: | widespread in plants | Reference: | Phytochemistry 9: 1669 (1970) | Generic_name: | 16,17-ANDROSTENE-3-OL | Chemical_iupac_name: | 16,17-ANDROSTENE-3-OL | Drug_type: | Experimental | Drugbank_id: | EXPT00580 | Logp: | 4.38 | Drug_category: | Constitutive Androstane Receptor inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
UBP6 |
Replicates: |
2 |
Raw OD Value: r im |
0.6735±0.00650538 |
Normalized OD Score: sc h |
1.0114±0.00997671 |
Z-Score: |
0.4454±0.37328 |
p-Value: |
0.66703 |
Z-Factor: |
-5.52514 |
Fitness Defect: |
0.4049 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 10|F3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.70 Celcius | Date: | 2008-01-24 YYYY-MM-DD | Plate CH Control (+): | 0.04265±0.00094 | Plate DMSO Control (-): | 0.644425±0.01290 | Plate Z-Factor: | 0.9320 |
| png ps pdf |
6174178 |
(E)-octadec-6-en-1-ol |
6281282 |
(E)-tetracos-15-en-1-ol |
6366560 |
(E)-undec-8-en-1-ol |
6366561 |
(E)-undec-7-en-1-ol |
6428644 |
(3S,5S)-17-(5-ethyl-6-methyl-heptan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cycl openta[a]phenanthren-3-ol |
6428645 |
(3S,5S)-17-[(E)-5-ethyl-6-methyl-hept-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetrad ecahydro-1H-cyclopenta[a]phenanthren-3-ol |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|