Compound Information | SONAR Target prediction | Name: | beta-AMYRIN | Unique Identifier: | SPE00100360 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.864 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 | Class: | triterpene | Source: | widespread in plants | Reference: | Phytochemistry 9: 1669 (1970) | Generic_name: | 16,17-ANDROSTENE-3-OL | Chemical_iupac_name: | 16,17-ANDROSTENE-3-OL | Drug_type: | Experimental | Drugbank_id: | EXPT00580 | Logp: | 4.38 | Drug_category: | Constitutive Androstane Receptor inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
RVS167 |
Replicates: |
2 |
Raw OD Value: r im |
0.7362±0.00219203 |
Normalized OD Score: sc h |
0.9878±0.00104617 |
Z-Score: |
-0.6768±0.0337383 |
p-Value: |
0.498672 |
Z-Factor: |
-51.5919 |
Fitness Defect: |
0.6958 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 1|H10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.80 Celcius | Date: | 2007-11-14 YYYY-MM-DD | Plate CH Control (+): | 0.040525000000000005±0.00054 | Plate DMSO Control (-): | 0.7305250000000001±0.03953 | Plate Z-Factor: | 0.8399 |
| png ps pdf |
5379873 |
17-[(E)-5-ethyl-6-methyl-hept-3-en-2-yl]-4,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahy dro-1H-cyclopenta[a]phenanthren-3-ol |
5380359 |
1-methylcyclooctan-1-ol; (1Z)-1-methylcyclooctene |
5380962 |
(E)-dec-7-en-1-ol |
5458935 |
(3S,4aS,6aR,8aR,12aS,14aS,14bS)-4,4,6a,6a,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,8,9,10,12,12a,13,14,14a-t etradecahydropicen-3-ol |
5459140 |
n/a |
5911048 |
(E)-docos-13-en-1-ol |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|