Compound Information | SONAR Target prediction | Name: | beta-AMYRIN | Unique Identifier: | SPE00100360 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.864 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 | Class: | triterpene | Source: | widespread in plants | Reference: | Phytochemistry 9: 1669 (1970) | Generic_name: | 16,17-ANDROSTENE-3-OL | Chemical_iupac_name: | 16,17-ANDROSTENE-3-OL | Drug_type: | Experimental | Drugbank_id: | EXPT00580 | Logp: | 4.38 | Drug_category: | Constitutive Androstane Receptor inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
MSN5 |
Replicates: |
2 |
Raw OD Value: r im |
0.6815±0.00820244 |
Normalized OD Score: sc h |
1.0021±0.0147105 |
Z-Score: |
0.1189±0.721999 |
p-Value: |
0.612198 |
Z-Factor: |
-28.3267 |
Fitness Defect: |
0.4907 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 10|F3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.60 Celcius | Date: | 2008-02-29 YYYY-MM-DD | Plate CH Control (+): | 0.040900000000000006±0.00069 | Plate DMSO Control (-): | 0.6709499999999999±0.01474 | Plate Z-Factor: | 0.9268 |
| png ps pdf |
5364469 |
(E)-dodec-8-en-1-ol |
5364483 |
(E)-pentadec-10-en-1-ol |
5364514 |
(9E)-cycloheptadec-9-en-1-ol |
5364523 |
(E)-icos-9-en-1-ol |
5364635 |
(E)-pentadec-11-en-1-ol |
5364671 |
17-[(E)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-c yclopenta[a]phenanthren-3-ol |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|