| Compound Information | SONAR Target prediction |  | Name: | beta-AMYRIN |  | Unique Identifier: | SPE00100360  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 376.32 g/mol |  | X log p: | 2.864  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 0 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 1 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 |  | Class: | triterpene |  | Source: | widespread in plants |  | Reference: | Phytochemistry 9: 1669 (1970) |  | Generic_name: | 16,17-ANDROSTENE-3-OL |  | Chemical_iupac_name: | 16,17-ANDROSTENE-3-OL |  | Drug_type: | Experimental |  | Drugbank_id: | EXPT00580 |  | Logp: | 4.38 |  | Drug_category: | Constitutive Androstane Receptor inhibitor |  | Organisms_affected: | -1 |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		AAT2 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7216±0.00671751 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9803±0.00434352 | 
	 
	
		| Z-Score: | 
		-1.0430±0.207465 | 
	 
	
		| p-Value: | 
		0.302112 | 
	 
	
		| Z-Factor: | 
		-4.47955 | 
	 
	
		| Fitness Defect: | 
		1.197 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 10|F3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.20 Celcius |  | Date: | 2008-04-08 YYYY-MM-DD |  | Plate CH Control (+): | 0.04045±0.00110 |  | Plate DMSO Control (-): | 0.7124250000000001±0.01605 |  | Plate Z-Factor: | 0.9098 |  
  |  png ps pdf |  
 
 
	
		| 5364469 | 
		(E)-dodec-8-en-1-ol | 
	 
	
		| 5364483 | 
		(E)-pentadec-10-en-1-ol | 
	 
	
		| 5364514 | 
		(9E)-cycloheptadec-9-en-1-ol | 
	 
	
		| 5364523 | 
		(E)-icos-9-en-1-ol | 
	 
	
		| 5364635 | 
		(E)-pentadec-11-en-1-ol | 
	 
	
		| 5364671 | 
		17-[(E)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-c yclopenta[a]phenanthren-3-ol | 
	 
 
 | internal high similarity DBLink  | Rows returned: 8 | 1 2 Next >>  |   
 |  active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 |  |   
 
 |