Compound Information | SONAR Target prediction | Name: | beta-AMYRIN | Unique Identifier: | SPE00100360 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.864 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 | Class: | triterpene | Source: | widespread in plants | Reference: | Phytochemistry 9: 1669 (1970) | Generic_name: | 16,17-ANDROSTENE-3-OL | Chemical_iupac_name: | 16,17-ANDROSTENE-3-OL | Drug_type: | Experimental | Drugbank_id: | EXPT00580 | Logp: | 4.38 | Drug_category: | Constitutive Androstane Receptor inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
PEX11 |
Replicates: |
2 |
Raw OD Value: r im |
0.7015±0.00494975 |
Normalized OD Score: sc h |
0.9803±0.00618002 |
Z-Score: |
-1.1372±0.262825 |
p-Value: |
0.263616 |
Z-Factor: |
-45.9277 |
Fitness Defect: |
1.3333 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 1|H10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.80 Celcius | Date: | 2007-10-23 YYYY-MM-DD | Plate CH Control (+): | 0.04005±0.00123 | Plate DMSO Control (-): | 0.7044250000000001±0.10604 | Plate Z-Factor: | 0.5005 |
| png ps pdf |
3601400 |
10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
3637354 |
4-(1,2,4-trimethyl-1-cyclohex-3-enyl)butan-2-ol |
3703914 |
10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-ol |
3713933 |
13,17-dimethyl-2,3,6,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol |
3829231 |
13-methyl-17-propyl-2,3,6,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol |
3855091 |
n/a |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|