Compound Information | SONAR Target prediction | Name: | beta-AMYRIN | Unique Identifier: | SPE00100360 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.864 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 | Class: | triterpene | Source: | widespread in plants | Reference: | Phytochemistry 9: 1669 (1970) | Generic_name: | 16,17-ANDROSTENE-3-OL | Chemical_iupac_name: | 16,17-ANDROSTENE-3-OL | Drug_type: | Experimental | Drugbank_id: | EXPT00580 | Logp: | 4.38 | Drug_category: | Constitutive Androstane Receptor inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
IDH2 |
Replicates: |
2 |
Raw OD Value: r im |
0.5864±0.00940452 |
Normalized OD Score: sc h |
0.9940±0.0177676 |
Z-Score: |
-0.2916±0.882939 |
p-Value: |
0.549516 |
Z-Factor: |
-31.0917 |
Fitness Defect: |
0.5987 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 1|H10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.50 Celcius | Date: | 2007-10-19 YYYY-MM-DD | Plate CH Control (+): | 0.040875±0.00327 | Plate DMSO Control (-): | 0.58155±0.04878 | Plate Z-Factor: | 0.7281 |
| png ps pdf |
3008607 |
(3R,6aR,6bS,8aR,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahyd ropicen-3-ol |
3008608 |
(3R,6aR,6bS,8aR,11R,14bS)-4,4,6a,6b,8a,11,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradeca hydro-1H-picen-3-ol |
3034659 |
(3S,6aR,6aR,6bR,8aS,12S,12aR,14aS,14bS)-4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,6a,7,8,9,12,12a,13, 14,14a-tetradecahydro-1H-picen-3-ol |
3036460 |
3-methyl-9-(2,3,6,6-tetramethyl-1-cyclohexenyl)nonan-1-ol |
3462371 |
4,4,6a,6b,9,11,12,14b-octamethyl-1,2,3,4a,5,6,7,8,8a,9,10,11,12,12a,14,14a-hexadecahydropicen-3-ol |
3575286 |
1-(1,2,4-trimethyl-1-cyclohex-3-enyl)pentan-3-ol |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|