Compound Information | SONAR Target prediction | Name: | beta-AMYRIN | Unique Identifier: | SPE00100360 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.864 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 | Class: | triterpene | Source: | widespread in plants | Reference: | Phytochemistry 9: 1669 (1970) | Generic_name: | 16,17-ANDROSTENE-3-OL | Chemical_iupac_name: | 16,17-ANDROSTENE-3-OL | Drug_type: | Experimental | Drugbank_id: | EXPT00580 | Logp: | 4.38 | Drug_category: | Constitutive Androstane Receptor inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
CLB2 |
Replicates: |
2 |
Raw OD Value: r im |
0.6794±0.00113137 |
Normalized OD Score: sc h |
0.9841±0.00294322 |
Z-Score: |
-0.9154±0.149083 |
p-Value: |
0.362658 |
Z-Factor: |
-36.3338 |
Fitness Defect: |
1.0143 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 1|H10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.60 Celcius | Date: | 2007-11-02 YYYY-MM-DD | Plate CH Control (+): | 0.041749999999999995±0.00249 | Plate DMSO Control (-): | 0.6806999999999999±0.08989 | Plate Z-Factor: | 0.5570 |
| png ps pdf |
1747972 |
(2S)-2-methyl-4-[(1R)-2,2,3-trimethyl-1-cyclopent-3-enyl]butan-1-ol |
1747973 |
(2S)-2-methyl-4-[(1S)-2,2,3-trimethyl-1-cyclopent-3-enyl]butan-1-ol |
1797856 |
(3S)-1-[(1R,2R)-1,2,4-trimethyl-1-cyclohex-3-enyl]pentan-3-ol |
2748207 |
(3R,5R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
2748228 |
4-(10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentan-1-o l |
2825522 |
13-methyl-1,2,3,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|