Compound Information | SONAR Target prediction | Name: | beta-AMYRIN | Unique Identifier: | SPE00100360 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.864 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 | Class: | triterpene | Source: | widespread in plants | Reference: | Phytochemistry 9: 1669 (1970) | Generic_name: | 16,17-ANDROSTENE-3-OL | Chemical_iupac_name: | 16,17-ANDROSTENE-3-OL | Drug_type: | Experimental | Drugbank_id: | EXPT00580 | Logp: | 4.38 | Drug_category: | Constitutive Androstane Receptor inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
MT2481-pdr1pdr3 |
Replicates: |
2 |
Raw OD Value: r im |
0.7173±0.0185262 |
Normalized OD Score: sc h |
1.0101±0.00963997 |
Z-Score: |
0.3172±0.298647 |
p-Value: |
0.756416 |
Z-Factor: |
-4.20128 |
Fitness Defect: |
0.2792 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 1|H10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.10 Celcius | Date: | 2006-05-02 YYYY-MM-DD | Plate CH Control (+): | 0.038474999999999995±0.00168 | Plate DMSO Control (-): | 0.69955±0.01240 | Plate Z-Factor: | 0.9391 |
| png ps pdf |
634717 |
17-(5-ethyl-6-methyl-heptan-2-yl)-4,10,13-trimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopen ta[a]phenanthren-3-ol |
635979 |
n/a |
1712010 |
(Z)-tetradec-11-en-1-ol |
1712011 |
(E)-tetradec-11-en-1-ol |
1747970 |
(2R)-2-methyl-4-[(1R)-2,2,3-trimethyl-1-cyclopent-3-enyl]butan-1-ol |
1747971 |
(2R)-2-methyl-4-[(1S)-2,2,3-trimethyl-1-cyclopent-3-enyl]butan-1-ol |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|