Compound Information | SONAR Target prediction | Name: | beta-AMYRIN | Unique Identifier: | SPE00100360 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.864 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 | Class: | triterpene | Source: | widespread in plants | Reference: | Phytochemistry 9: 1669 (1970) | Generic_name: | 16,17-ANDROSTENE-3-OL | Chemical_iupac_name: | 16,17-ANDROSTENE-3-OL | Drug_type: | Experimental | Drugbank_id: | EXPT00580 | Logp: | 4.38 | Drug_category: | Constitutive Androstane Receptor inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
SNC1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7019±0.00388909 |
Normalized OD Score: sc h |
0.9881±0.00375049 |
Z-Score: |
-0.6833±0.228598 |
p-Value: |
0.500022 |
Z-Factor: |
-4.03094 |
Fitness Defect: |
0.6931 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 10|F3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.20 Celcius | Date: | 2008-04-24 YYYY-MM-DD | Plate CH Control (+): | 0.0409±0.00076 | Plate DMSO Control (-): | 0.70295±0.00939 | Plate Z-Factor: | 0.9490 |
| png ps pdf |
625530 |
4,10,13-trimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phena nthren-3-ol |
627304 |
4,4,10,13-tetramethyl-17-(6-methylheptan-2-yl)-1,2,3,5,6,7,8,9,11,12,16,17-dodecahydrocyclopenta[a]phena nthren-3-ol |
627427 |
4,4,10,13-tetramethyl-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-ol |
631255 |
4-(10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentan-1-ol |
633937 |
4,4,6a,8a,11,12,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,11,12,12a,13,14,14a-hexadecahydropicen-3-ol |
634400 |
17-(5-ethyl-6-methyl-heptan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[ a]phenanthren-3-ol |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|