| Compound Information | SONAR Target prediction | | Name: | beta-AMYRIN | | Unique Identifier: | SPE00100360 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 376.32 g/mol | | X log p: | 2.864 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 | | Class: | triterpene | | Source: | widespread in plants | | Reference: | Phytochemistry 9: 1669 (1970) | | Generic_name: | 16,17-ANDROSTENE-3-OL | | Chemical_iupac_name: | 16,17-ANDROSTENE-3-OL | | Drug_type: | Experimental | | Drugbank_id: | EXPT00580 | | Logp: | 4.38 | | Drug_category: | Constitutive Androstane Receptor inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
HOC1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6203±0.0120208 |
| Normalized OD Score: sc h |
0.9903±0.00649874 |
| Z-Score: |
-0.3391±0.261837 |
| p-Value: |
0.738844 |
| Z-Factor: |
-7.64052 |
| Fitness Defect: |
0.3027 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 1|H10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.60 Celcius | | Date: | 2006-02-14 YYYY-MM-DD | | Plate CH Control (+): | 0.039474999999999996±0.00068 | | Plate DMSO Control (-): | 0.6219±0.01908 | | Plate Z-Factor: | 0.8378 |
|  png
ps
pdf |
| 444634 |
(3S)-3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexenyl)nonan-1-ol |
| 448059 |
(E,3S)-3,7-dimethyl-9-[(1S)-2,2,6-trimethylcyclohexyl]non-8-en-1-ol |
| 500043 |
n/a |
| 521754 |
10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenant
hren-3-ol |
| 534620 |
7-(2-octyl-1-cyclopropenyl)heptan-1-ol |
| 556375 |
3-(1-cyclohex-3-enyl)propan-1-ol |
| internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
| active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|
