Compound Information | SONAR Target prediction | Name: | beta-AMYRIN | Unique Identifier: | SPE00100360 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 2.864 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 | Class: | triterpene | Source: | widespread in plants | Reference: | Phytochemistry 9: 1669 (1970) | Generic_name: | 16,17-ANDROSTENE-3-OL | Chemical_iupac_name: | 16,17-ANDROSTENE-3-OL | Drug_type: | Experimental | Drugbank_id: | EXPT00580 | Logp: | 4.38 | Drug_category: | Constitutive Androstane Receptor inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
BY4741-2nd |
Replicates: |
2 |
Raw OD Value: r im |
0.9340±0.0160513 |
Normalized OD Score: sc h |
0.9952±0.00837672 |
Z-Score: |
-0.3636±0.34439 |
p-Value: |
0.724118 |
Z-Factor: |
-4.81668 |
Fitness Defect: |
0.3228 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 14|F6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2012-05-28 YYYY-MM-DD | Plate CH Control (+): | 0.09250000000000001±0.00457 | Plate DMSO Control (-): | 0.9265000000000002±0.02572 | Plate Z-Factor: | 0.8910 |
| png ps pdf |
444634 |
(3S)-3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexenyl)nonan-1-ol |
448059 |
(E,3S)-3,7-dimethyl-9-[(1S)-2,2,6-trimethylcyclohexyl]non-8-en-1-ol |
500043 |
n/a |
521754 |
10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenant hren-3-ol |
534620 |
7-(2-octyl-1-cyclopropenyl)heptan-1-ol |
556375 |
3-(1-cyclohex-3-enyl)propan-1-ol |
internal high similarity DBLink | Rows returned: 8 | 1 2 Next >> |
active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|