| Compound Information | SONAR Target prediction | | Name: | isopropyl N-(3,5-dichlorophenyl)carbamate | | Unique Identifier: | SPB 07912 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C10H11NO2Cl2 | | Molecular Weight: | 237.018 g/mol | | X log p: | 7.707 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(C)OC(=O)Nc1cc(Cl)cc(Cl)c1 |
| Species: |
4932 |
| Condition: |
YCK3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7570±0.00707107 |
| Normalized OD Score: sc h |
0.8453±0.000781287 |
| Z-Score: |
-0.8706±0.0118882 |
| p-Value: |
0.383964 |
| Z-Factor: |
0.480495 |
| Fitness Defect: |
0.9572 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Bioactive | | Plate Number and Position: | 9|H5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2011-06-14 YYYY-MM-DD | | Plate CH Control (+): | 0.10075±0.00694 | | Plate DMSO Control (-): | 0.9675±0.02441 | | Plate Z-Factor: | 0.9033 |
| png ps pdf |
| DBLink | Rows returned: 2 | |
| 2747130 |
propan-2-yl N-(3,5-dichlorophenyl)carbamate |
| 4935479 |
tert-butyl N-(3,5-dichlorophenyl)carbamate |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 17219 | Additional Members: 19 | Rows returned: 0 | |
|