| 
 | Compound Information | SONAR Target prediction |  | Name: | isopropyl N-(3,5-dichlorophenyl)carbamate |  | Unique Identifier: | SPB 07912 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C10H11NO2Cl2 |  | Molecular Weight: | 237.018 g/mol |  | X log p: | 7.707  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | CC(C)OC(=O)Nc1cc(Cl)cc(Cl)c1 | 
 
 
	
		| Species: | 4932 |  
		| Condition: | BY4741-2nd |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6505±0.0148492 |  
		| Normalized OD Score: sc h | 0.7106±0.00191013 |  
		| Z-Score: | -2.3657±0.119841 |  
		| p-Value: | 0.0184103 |  
		| Z-Factor: | 0.788805 |  
		| Fitness Defect: | 3.9948 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Bioactive |  | Plate Number and Position: | 9|H5 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 595 nm |  | Robot Temperature: | 30.00 Celcius |  | Date: | 2010-08-10 YYYY-MM-DD |  | Plate CH Control (+): | 0.09275±0.00713 |  | Plate DMSO Control (-): | 0.9924999999999999±0.01819 |  | Plate Z-Factor: | 0.9159 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 2 |  | 
 
	
		| 2747130 | propan-2-yl N-(3,5-dichlorophenyl)carbamate |  
		| 4935479 | tert-butyl N-(3,5-dichlorophenyl)carbamate |  
 | internal high similarity DBLink  | Rows returned: 3 |  | 
 
 | active | Cluster 17219 | Additional Members: 19 | Rows returned: 0 |  | 
 
 |