Compound Information | SONAR Target prediction | Name: | isopropyl N-(3,5-dichlorophenyl)carbamate | Unique Identifier: | SPB 07912 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C10H11NO2Cl2 | Molecular Weight: | 237.018 g/mol | X log p: | 7.707 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(C)OC(=O)Nc1cc(Cl)cc(Cl)c1 |
Species: |
4932 |
Condition: |
CKA2 |
Replicates: |
2 |
Raw OD Value: r im |
0.8185±0.0629325 |
Normalized OD Score: sc h |
0.8746±0.0560336 |
Z-Score: |
-0.9014±0.41857 |
p-Value: |
0.38802 |
Z-Factor: |
-0.914205 |
Fitness Defect: |
0.9467 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Bioactive | Plate Number and Position: | 9|H5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2011-06-14 YYYY-MM-DD | Plate CH Control (+): | 0.09875±0.01133 | Plate DMSO Control (-): | 0.9612499999999999±0.02394 | Plate Z-Factor: | 0.8709 |
| png ps pdf |
DBLink | Rows returned: 2 | |
2747130 |
propan-2-yl N-(3,5-dichlorophenyl)carbamate |
4935479 |
tert-butyl N-(3,5-dichlorophenyl)carbamate |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 17219 | Additional Members: 19 | Rows returned: 0 | |
|