Compound Information | SONAR Target prediction | Name: | N`4,3-di(2,6-dichlorophenyl)-5-methylisoxazole-4-carbohydrazide | Unique Identifier: | SPB 00192 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H11N3O2Cl4 | Molecular Weight: | 420.012 g/mol | X log p: | 15.199 (online calculus) | Lipinksi Failures | 1 | TPSA | 38.66 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 5 | Canonical Smiles: | Cc1onc(c1C(=O)NNc1c(Cl)cccc1Cl)c1c(Cl)cccc1Cl |
Species: |
4932 |
Condition: |
pdryCG200 |
Replicates: |
2 |
Raw OD Value: r im |
0.3420±0.0113137 |
Normalized OD Score: sc h |
0.3287±0.00800633 |
Z-Score: |
-30.4781±1.22855 |
p-Value: |
0 |
Z-Factor: |
0.868967 |
Fitness Defect: |
INF |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Bioactive | Plate Number and Position: | 8|E8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2010-08-10 YYYY-MM-DD | Plate CH Control (+): | 0.0925±0.01394 | Plate DMSO Control (-): | 1.00475±0.02151 | Plate Z-Factor: | 0.8757 |
| png ps pdf |
DBLink | Rows returned: 1 | |
2743078 |
N-,3-bis(2,6-dichlorophenyl)-5-methyl-oxazole-4-carbohydrazide |
internal high similarity DBLink | Rows returned: 6 | |
nonactive | Cluster 8647 | Additional Members: 126 | Rows returned: 5 | |
|