Compound Information | SONAR Target prediction | Name: | N`4,3-di(2,6-dichlorophenyl)-5-methylisoxazole-4-carbohydrazide | Unique Identifier: | SPB 00192 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H11N3O2Cl4 | Molecular Weight: | 420.012 g/mol | X log p: | 15.199 (online calculus) | Lipinksi Failures | 1 | TPSA | 38.66 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 5 | Canonical Smiles: | Cc1onc(c1C(=O)NNc1c(Cl)cccc1Cl)c1c(Cl)cccc1Cl |
Species: |
4932 |
Condition: |
SLN1 |
Replicates: |
2 |
Raw OD Value: r im |
0.9065±0.137886 |
Normalized OD Score: sc h |
0.9771±0.00548856 |
Z-Score: |
0.0463±0.380655 |
p-Value: |
0.788026 |
Z-Factor: |
-1.30577 |
Fitness Defect: |
0.2382 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Bioactive | Plate Number and Position: | 8|E8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2012-05-28 YYYY-MM-DD | Plate CH Control (+): | 0.09699999999999999±0.00463 | Plate DMSO Control (-): | 0.89575±0.01202 | Plate Z-Factor: | 0.9329 |
| png ps pdf |
DBLink | Rows returned: 1 | |
2743078 |
N-,3-bis(2,6-dichlorophenyl)-5-methyl-oxazole-4-carbohydrazide |
internal high similarity DBLink | Rows returned: 6 | |
active | Cluster 8647 | Additional Members: 126 | Rows returned: 3 | |
|