| Compound Information | SONAR Target prediction | | Name: | N`4,3-di(2,6-dichlorophenyl)-5-methylisoxazole-4-carbohydrazide | | Unique Identifier: | SPB 00192 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C17H11N3O2Cl4 | | Molecular Weight: | 420.012 g/mol | | X log p: | 15.199 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 38.66 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | Cc1onc(c1C(=O)NNc1c(Cl)cccc1Cl)c1c(Cl)cccc1Cl |
| Species: |
4932 |
| Condition: |
HOG1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6065±0.0275772 |
| Normalized OD Score: sc h |
0.8274±0.0258701 |
| Z-Score: |
-5.0210±0.483738 |
| p-Value: |
0.00000148274 |
| Z-Factor: |
-0.0756721 |
| Fitness Defect: |
13.4216 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Bioactive | | Plate Number and Position: | 8|E8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2010-08-10 YYYY-MM-DD | | Plate CH Control (+): | 0.095±0.00876 | | Plate DMSO Control (-): | 0.849±0.03254 | | Plate Z-Factor: | 0.8338 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 2743078 |
N-,3-bis(2,6-dichlorophenyl)-5-methyl-oxazole-4-carbohydrazide |
| internal high similarity DBLink | Rows returned: 6 | |
| active | Cluster 8647 | Additional Members: 126 | Rows returned: 3 | |
|
