| Compound Information | SONAR Target prediction | | Name: | | | Unique Identifier: | S001-0029 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C10H14N6O3 | | Molecular Weight: | 252.146 g/mol | | X log p: | -0.163 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 49.55 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 9 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | Nc1nc(N)c2ncn(C3CC(O)C(CO)O3)c2n1 |
| Species: |
4932 |
| Condition: |
gpr1-2nd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8256±0.00268701 |
| Normalized OD Score: sc h |
1.0068±0.00518422 |
| Z-Score: |
0.1646±0.103325 |
| p-Value: |
0.869592 |
| Z-Factor: |
-7.57737 |
| Fitness Defect: |
0.1397 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | ChemDiv-Kinase | | Plate Number and Position: | 13|G6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-08-16 YYYY-MM-DD | | Plate CH Control (+): | 0.0444±0.00313 | | Plate DMSO Control (-): | 0.82365±0.02882 | | Plate Z-Factor: | 0.8909 |
|  png
ps
pdf |
| DBLink | Rows returned: 3 | |
| 97188 |
(2R,3S,5R)-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| 266446 |
5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| 451881 |
(2R,3R,5R)-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 4055 | Additional Members: 6 | Rows returned: 0 | |
|
