| 
 | Compound Information | SONAR Target prediction |  | Name: | 5,7-dihydroxy-2,3-diphenyl-4H-chromen-4-one |  | Unique Identifier: | RJC 00213 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C21H14O4 |  | Molecular Weight: | 316.222 g/mol |  | X log p: | 25.033  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | Oc1cc(O)c2C(=O)C(c3ccccc3)=C(Oc2c1)c1ccccc1 | 
 
 
	
		| Species: | 4932 |  
		| Condition: | BCK1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.0855±0.000707107 |  
		| Normalized OD Score: sc h | 0.1644±0.0024638 |  
		| Z-Score: | -5.6931±0.497298 |  
		| p-Value: | 0.0000000468438 |  
		| Z-Factor: | 0.846066 |  
		| Fitness Defect: | 16.8764 |  
		| Bioactivity Statement: | Toxic |  | | Experimental Conditions |  |  | Library: | Cytotoxic |  | Plate Number and Position: | 7|C10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 595 nm |  | Robot Temperature: | 30.00 Celcius |  | Date: | 2010-08-10 YYYY-MM-DD |  | Plate CH Control (+): | 0.09025±0.00283 |  | Plate DMSO Control (-): | 0.95775±0.03803 |  | Plate Z-Factor: | 0.8578 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 1 |  | 
 
	
		| 5904559 | 5,7-dihydroxy-2,3-diphenyl-chromen-4-one |  
 | internal high similarity DBLink  | Rows returned: 1 |  | 
 
 | active | Cluster 10732 | Additional Members: 22 | Rows returned: 7 | 1 2 Next >> | 
 
 |