| Compound Information | SONAR Target prediction | | Name: | 5,7-dihydroxy-2,3-diphenyl-4H-chromen-4-one | | Unique Identifier: | RJC 00213 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C21H14O4 | | Molecular Weight: | 316.222 g/mol | | X log p: | 25.033 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | Oc1cc(O)c2C(=O)C(c3ccccc3)=C(Oc2c1)c1ccccc1 |
| Species: |
4932 |
| Condition: |
HOG1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.1365±0.0473762 |
| Normalized OD Score: sc h |
0.3199±0.103349 |
| Z-Score: |
-5.4163±1.72629 |
| p-Value: |
0.0000136038 |
| Z-Factor: |
0.306844 |
| Fitness Defect: |
11.2052 |
| Bioactivity Statement: |
Toxic |
| Experimental Conditions | | | Library: | Cytotoxic | | Plate Number and Position: | 7|C10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2010-08-10 YYYY-MM-DD | | Plate CH Control (+): | 0.09775±0.01121 | | Plate DMSO Control (-): | 0.8212499999999999±0.04498 | | Plate Z-Factor: | 0.7318 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 5904559 |
5,7-dihydroxy-2,3-diphenyl-chromen-4-one |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 10732 | Additional Members: 22 | Rows returned: 7 | 1 2 Next >> |
|
