| Compound Information | SONAR Target prediction | | Name: | 5,7-dihydroxy-2,3-diphenyl-4H-chromen-4-one | | Unique Identifier: | RJC 00213 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C21H14O4 | | Molecular Weight: | 316.222 g/mol | | X log p: | 25.033 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | Oc1cc(O)c2C(=O)C(c3ccccc3)=C(Oc2c1)c1ccccc1 |
| Species: |
4932 |
| Condition: |
RIO2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.1115±0.00494975 |
| Normalized OD Score: sc h |
0.1171±0.00493589 |
| Z-Score: |
-10.6414±0.971658 |
| p-Value: |
1.20748e-23 |
| Z-Factor: |
0.856036 |
| Fitness Defect: |
52.7709 |
| Bioactivity Statement: |
Toxic |
| Experimental Conditions | | | Library: | Cytotoxic | | Plate Number and Position: | 7|C10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2010-08-10 YYYY-MM-DD | | Plate CH Control (+): | 0.09575±0.00337 | | Plate DMSO Control (-): | 0.95375±0.03577 | | Plate Z-Factor: | 0.8526 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 5904559 |
5,7-dihydroxy-2,3-diphenyl-chromen-4-one |
| internal high similarity DBLink | Rows returned: 1 | |
|