| 
 | Compound Information | SONAR Target prediction |  | Name: | 5,7-dihydroxy-2,3-diphenyl-4H-chromen-4-one |  | Unique Identifier: | RJC 00213 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C21H14O4 |  | Molecular Weight: | 316.222 g/mol |  | X log p: | 25.033  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | Oc1cc(O)c2C(=O)C(c3ccccc3)=C(Oc2c1)c1ccccc1 | 
 
 
	
		| Species: | 4932 |  
		| Condition: | nnk1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.2500±0.159806 |  
		| Normalized OD Score: sc h | 0.2691±0.16906 |  
		| Z-Score: | -14.8740±13.1523 |  
		| p-Value: | 0.0000000124564 |  
		| Z-Factor: | 0.184162 |  
		| Fitness Defect: | 18.201 |  
		| Bioactivity Statement: | Toxic |  | | Experimental Conditions |  |  | Library: | Cytotoxic |  | Plate Number and Position: | 7|C10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 595 nm |  | Robot Temperature: | 30.00 Celcius |  | Date: | 2010-08-10 YYYY-MM-DD |  | Plate CH Control (+): | 0.10175000000000001±0.01838 |  | Plate DMSO Control (-): | 0.90725±0.02784 |  | Plate Z-Factor: | 0.7862 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 1 |  | 
 
	
		| 5904559 | 5,7-dihydroxy-2,3-diphenyl-chromen-4-one |  
 | internal high similarity DBLink  | Rows returned: 1 |  | 
 
 
 |