Compound Information | SONAR Target prediction | Name: | N4-(1,1,3,3-tetramethylbutyl)-3-(2,6-dichlorophenyl)-5-methylisoxazole -4-carboxamide | Unique Identifier: | RF 00040 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C19H24N2O2Cl2 | Molecular Weight: | 359.121 g/mol | X log p: | 7.455 (online calculus) | Lipinksi Failures | 1 | TPSA | 38.66 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 6 | Canonical Smiles: | Cc1onc(c1C(=O)NC(C)(C)CC(C)(C)C)c1c(Cl)cccc1Cl |
Species: |
4932 |
Condition: |
pdryCG200 |
Replicates: |
2 |
Raw OD Value: r im |
0.7730±0.0212132 |
Normalized OD Score: sc h |
0.7408±0.0513895 |
Z-Score: |
-11.7251±3.09236 |
p-Value: |
7.24912e-22 |
Z-Factor: |
0.0267697 |
Fitness Defect: |
48.676 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Bioactive | Plate Number and Position: | 6|D3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2010-08-10 YYYY-MM-DD | Plate CH Control (+): | 0.09075±0.00459 | Plate DMSO Control (-): | 1.0205±0.03117 | Plate Z-Factor: | 0.8778 |
| png ps pdf |
718143 |
3-(2,6-dichlorophenyl)-5-methyl-N-[(2S)-pentan-2-yl]oxazole-4-carboxamide |
718146 |
3-(2,6-dichlorophenyl)-5-methyl-N-[(2R)-pentan-2-yl]oxazole-4-carboxamide |
788820 |
3-(2-chlorophenyl)-5-methyl-N-[(2R)-pentan-2-yl]oxazole-4-carboxamide |
788821 |
3-(2-chlorophenyl)-5-methyl-N-[(2S)-pentan-2-yl]oxazole-4-carboxamide |
2726032 |
3-(2,6-dichlorophenyl)-5-methyl-N-(2,4,4-trimethylpentan-2-yl)oxazole-4-carboxamide |
2886297 |
3-(2,6-dichlorophenyl)-5-methyl-N-pentan-2-yl-oxazole-4-carboxamide |
internal high similarity DBLink | Rows returned: 23 | 1 2 3 4 Next >> |
active | Cluster 8647 | Additional Members: 126 | Rows returned: 3 | |
|