| Compound Information | SONAR Target prediction | | Name: | N4-(1,1,3,3-tetramethylbutyl)-3-(2,6-dichlorophenyl)-5-methylisoxazole
-4-carboxamide | | Unique Identifier: | RF 00040 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C19H24N2O2Cl2 | | Molecular Weight: | 359.121 g/mol | | X log p: | 7.455 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 38.66 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | Cc1onc(c1C(=O)NC(C)(C)CC(C)(C)C)c1c(Cl)cccc1Cl |
| Species: |
4932 |
| Condition: |
ADK1 |
| Replicates: |
2 |
| Raw OD Value: r im |
1.0260±0.00282843 |
| Normalized OD Score: sc h |
0.9987±0.00160435 |
| Z-Score: |
1.0972±0.205588 |
| p-Value: |
0.277584 |
| Z-Factor: |
-8.43351 |
| Fitness Defect: |
1.2816 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Bioactive | | Plate Number and Position: | 6|D3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2012-05-28 YYYY-MM-DD | | Plate CH Control (+): | 0.32275±0.26851 | | Plate DMSO Control (-): | 0.9855±0.01610 | | Plate Z-Factor: | -2.7073 |
|  png
ps
pdf |
| 718143 |
3-(2,6-dichlorophenyl)-5-methyl-N-[(2S)-pentan-2-yl]oxazole-4-carboxamide |
| 718146 |
3-(2,6-dichlorophenyl)-5-methyl-N-[(2R)-pentan-2-yl]oxazole-4-carboxamide |
| 788820 |
3-(2-chlorophenyl)-5-methyl-N-[(2R)-pentan-2-yl]oxazole-4-carboxamide |
| 788821 |
3-(2-chlorophenyl)-5-methyl-N-[(2S)-pentan-2-yl]oxazole-4-carboxamide |
| 2726032 |
3-(2,6-dichlorophenyl)-5-methyl-N-(2,4,4-trimethylpentan-2-yl)oxazole-4-carboxamide |
| 2886297 |
3-(2,6-dichlorophenyl)-5-methyl-N-pentan-2-yl-oxazole-4-carboxamide |
| internal high similarity DBLink | Rows returned: 23 | 1 2 3 4 Next >> |
| active | Cluster 8647 | Additional Members: 126 | Rows returned: 3 | |
|
