Compound Information | SONAR Target prediction | Name: | N4-(1,1,3,3-tetramethylbutyl)-3-(2,6-dichlorophenyl)-5-methylisoxazole -4-carboxamide | Unique Identifier: | RF 00040 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C19H24N2O2Cl2 | Molecular Weight: | 359.121 g/mol | X log p: | 7.455 (online calculus) | Lipinksi Failures | 1 | TPSA | 38.66 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 6 | Canonical Smiles: | Cc1onc(c1C(=O)NC(C)(C)CC(C)(C)C)c1c(Cl)cccc1Cl |
Species: |
4932 |
Condition: |
pdryCG196 |
Replicates: |
2 |
Raw OD Value: r im |
0.6360±0.0169706 |
Normalized OD Score: sc h |
0.6239±0.00418432 |
Z-Score: |
-14.6987±2.26234 |
p-Value: |
1.66835e-39 |
Z-Factor: |
0.674061 |
Fitness Defect: |
89.289 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Bioactive | Plate Number and Position: | 6|D3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2010-08-10 YYYY-MM-DD | Plate CH Control (+): | 0.09125±0.00485 | Plate DMSO Control (-): | 0.9195±0.03378 | Plate Z-Factor: | 0.8796 |
| png ps pdf |
718143 |
3-(2,6-dichlorophenyl)-5-methyl-N-[(2S)-pentan-2-yl]oxazole-4-carboxamide |
718146 |
3-(2,6-dichlorophenyl)-5-methyl-N-[(2R)-pentan-2-yl]oxazole-4-carboxamide |
788820 |
3-(2-chlorophenyl)-5-methyl-N-[(2R)-pentan-2-yl]oxazole-4-carboxamide |
788821 |
3-(2-chlorophenyl)-5-methyl-N-[(2S)-pentan-2-yl]oxazole-4-carboxamide |
2726032 |
3-(2,6-dichlorophenyl)-5-methyl-N-(2,4,4-trimethylpentan-2-yl)oxazole-4-carboxamide |
2886297 |
3-(2,6-dichlorophenyl)-5-methyl-N-pentan-2-yl-oxazole-4-carboxamide |
nonactive | Cluster 8647 | Additional Members: 126 | Rows returned: 5 | |
|