| Compound Information | SONAR Target prediction | | Name: | Cycloheximide | | Unique Identifier: | Prest976 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H23NO4 | | Molecular Weight: | 259.173 g/mol | | X log p: | -1.079 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 51.21 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | CC1CC(C)C(=O)C(C1)C(O)CC1CC(=O)NC(=O)C1 |
| Species: |
9606 |
| Condition: |
TMPPre001 |
| Replicates: |
2 |
| Raw OD Value: r im |
868.0000±0 |
| Normalized OD Score: sc h |
1.0254±0 |
| Z-Score: |
0.5730±0 |
| p-Value: |
0.566656 |
| Z-Factor: |
-40.8589 |
| Fitness Defect: |
0.568 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 10|G11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.30 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 870.5±769.75857 | | Plate DMSO Control (-): | 982.5±305.13061 | | Plate Z-Factor: | -45.8313 |
|  png
ps
pdf |
| 6610291 |
4-[(2S)-2-[(1S,3S,5S)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
| 7059506 |
4-[(2R)-2-[(1S,3R,5R)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
| 7059507 |
4-[(2R)-2-[(1S,3R,5S)-3,5-dimethyl-2-oxo-cyclohexyl]-2-hydroxy-ethyl]piperidine-2,6-dione |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 1392 | Additional Members: 4 | Rows returned: 2 | |
|
