Compound Information | SONAR Target prediction | Name: | Pregnenolone | Unique Identifier: | Prest859 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C21H32O2 | Molecular Weight: | 287.247 g/mol | X log p: | 1.976 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC(=O)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC21C | Generic_name: | 3-BETA-HYDROXY-5-ANDROSTEN-17-ONE | Chemical_iupac_name: | 3-BETA-HYDROXY-5-ANDROSTEN-17-ONE | Drug_type: | Experimental | Drugbank_id: | EXPT00519 | Logp: | 3.73 | Drug_category: | Isomerase inhibitor | Organisms_affected: | -1 |
Species: |
9606 |
Condition: |
TMPPre001 |
Replicates: |
2 |
Raw OD Value: r im |
2166.0000±0 |
Normalized OD Score: sc h |
1.0848±0 |
Z-Score: |
1.9117±0 |
p-Value: |
0.0559102 |
Z-Factor: |
-3.22136 |
Fitness Defect: |
2.884 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 7|G7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 24.10 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 951.5±923.27222 | Plate DMSO Control (-): | 2006±543.99595 | Plate Z-Factor: | -4.4324 |
| png ps pdf |
7061331 |
1-[(3R,8R,9S,10R,13S,14R,16R,17S)-3-hydroxy-10,13,16,17-tetramethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecah ydrocyclopenta[a]phenanthren-17-yl]ethanone |
7061332 |
1-[(3R,8R,9S,10R,13S,14S,16R,17S)-3-hydroxy-10,13,16,17-tetramethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecah ydrocyclopenta[a]phenanthren-17-yl]ethanone |
7061333 |
1-[(3S,8R,9S,10R,13S,14R,16R,17S)-3-hydroxy-10,13,16,17-tetramethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecah ydrocyclopenta[a]phenanthren-17-yl]ethanone |
7061334 |
1-[(3S,8R,9S,10R,13S,14S,16R,17S)-3-hydroxy-10,13,16,17-tetramethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecah ydrocyclopenta[a]phenanthren-17-yl]ethanone |
7079807 |
n/a |
7079808 |
n/a |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 7902 | Additional Members: 9 | Rows returned: 4 | |
|