Compound Information | SONAR Target prediction | Name: | Metaproterenol sulfate, orciprenaline sulfate | Unique Identifier: | Prest845 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C22H36N2O10S | Molecular Weight: | 484.309 g/mol | X log p: | 5.855 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(C)NCC(O)c1cc(O)cc(O)c1.CC(C)NCC(O)c1cc(O)cc(O)c1.OS(O)(=O)=O |
Species: |
9606 |
Condition: |
TMPPre002 |
Replicates: |
2 |
Raw OD Value: r im |
9640.0000±0 |
Normalized OD Score: sc h |
0.9462±0 |
Z-Score: |
-1.2121±0 |
p-Value: |
0.225492 |
Z-Factor: |
-14.0282 |
Fitness Defect: |
1.4895 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 7|C6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 24.10 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 951.5±923.27222 | Plate DMSO Control (-): | 2006±543.99595 | Plate Z-Factor: | -4.4324 |
| png ps pdf |
DBLink | Rows returned: 4 | |
31620 |
[2-(3,5-dihydroxyphenyl)-2-hydroxy-ethyl]-tert-butyl-azanium sulfate |
441333 |
5-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,3-diol; sulfuric acid |
441334 |
5-[1-hydroxy-2-(tert-butylamino)ethyl]benzene-1,3-diol; sulfuric acid |
657301 |
5-[1-hydroxy-2-(tert-butylamino)ethyl]benzene-1,3-diol; sulfuric acid |
internal high similarity DBLink | Rows returned: 0 | |
|