Compound Information | SONAR Target prediction | Name: | Metampicillin sodium salt | Unique Identifier: | Prest828 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H18N3NaO4S | Molecular Weight: | 367.271 g/mol | X log p: | 8.577 (online calculus) | Lipinksi Failures | 1 | TPSA | 115.17 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 7 | Rotatable Bond Count: | 6 | Canonical Smiles: | [Na+].[O-]C(=O)C1N2C(SC1(C)C)C(NC(=O)C(N=C)c1ccccc1)C2=O |
Species: |
9606 |
Condition: |
TMPPre003 |
Replicates: |
2 |
Raw OD Value: r im |
18945.0000±0 |
Normalized OD Score: sc h |
1.0295±0 |
Z-Score: |
0.8219±0 |
p-Value: |
0.411114 |
Z-Factor: |
-4.6405 |
Fitness Defect: |
0.8889 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 3|H6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 23.60 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 18357.5±2177.01332 | Plate DMSO Control (-): | 18529.5±1551.44299 | Plate Z-Factor: | -61.5880 |
| png ps pdf |
DBLink | Rows returned: 6 | |
4083 |
3,3-dimethyl-6-[[2-(methylideneamino)-2-phenyl-acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-c arboxylate |
4084 |
3,3-dimethyl-6-[[2-(methylideneamino)-2-phenyl-acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-c arboxylic acid |
5702187 |
sodium 3,3-dimethyl-6-[[2-(methylideneamino)-2-phenyl-acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-c arboxylate |
6604508 |
sodium (2S,5R,6R)-3,3-dimethyl-6-[[(2S)-2-(methylideneamino)-2-phenyl-acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3 .2.0]heptane-2-carboxylate |
6604509 |
(2S,5R,6R)-3,3-dimethyl-6-[[(2S)-2-(methylideneamino)-2-phenyl-acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3 .2.0]heptane-2-carboxylic acid |
6713928 |
(2S,5R,6R)-3,3-dimethyl-6-[[(2R)-2-(methylideneamino)-2-phenyl-acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3 .2.0]heptane-2-carboxylic acid |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 3276 | Additional Members: 16 | Rows returned: 1 | |
|