| Compound Information | SONAR Target prediction | | Name: | Metampicillin sodium salt | | Unique Identifier: | Prest828 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C17H18N3NaO4S | | Molecular Weight: | 367.271 g/mol | | X log p: | 8.577 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 115.17 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 7 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | [Na+].[O-]C(=O)C1N2C(SC1(C)C)C(NC(=O)C(N=C)c1ccccc1)C2=O |
| Species: |
9606 |
| Condition: |
TMPPre002 |
| Replicates: |
2 |
| Raw OD Value: r im |
10547.5000±0 |
| Normalized OD Score: sc h |
1.0498±0 |
| Z-Score: |
1.1219±0 |
| p-Value: |
0.261912 |
| Z-Factor: |
-4.83748 |
| Fitness Defect: |
1.3397 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 3|H6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.60 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 1037.5±978.23463 | | Plate DMSO Control (-): | 2014±552.18250 | | Plate Z-Factor: | -4.9321 |
| png ps pdf |
| DBLink | Rows returned: 6 | |
| 4083 |
3,3-dimethyl-6-[[2-(methylideneamino)-2-phenyl-acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-c arboxylate |
| 4084 |
3,3-dimethyl-6-[[2-(methylideneamino)-2-phenyl-acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-c arboxylic acid |
| 5702187 |
sodium 3,3-dimethyl-6-[[2-(methylideneamino)-2-phenyl-acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-c arboxylate |
| 6604508 |
sodium (2S,5R,6R)-3,3-dimethyl-6-[[(2S)-2-(methylideneamino)-2-phenyl-acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3 .2.0]heptane-2-carboxylate |
| 6604509 |
(2S,5R,6R)-3,3-dimethyl-6-[[(2S)-2-(methylideneamino)-2-phenyl-acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3 .2.0]heptane-2-carboxylic acid |
| 6713928 |
(2S,5R,6R)-3,3-dimethyl-6-[[(2R)-2-(methylideneamino)-2-phenyl-acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3 .2.0]heptane-2-carboxylic acid |
| internal high similarity DBLink | Rows returned: 0 | |
|